C32H34N4O3S — CID 166162608
4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)-8-methylquinazolin-4-yl]-1,4-thiazepan-5-one (PubChem CID 166162608) has the molecular formula C32H34N4O3S and a molecular weight of 554.72 g/mol. Its IUPAC name is 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)-8-methylquinazolin-4-yl]-1,4-thiazepan-5-one.
| Compound Name | 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)-8-methylquinazolin-4-yl]-1,4-thiazepan-5-one |
|---|---|
| PubChem CID | 166162608 |
| Molecular Formula | C32H34N4O3S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)-8-methylquinazolin-4-yl]-1,4-thiazepan-5-one |
| SMILES | Cc1c(-c2cc(O)cc3ccccc23)ccc2c(N3CCSCCC3=O)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C32H34N4O3S/c1-21-24(27-19-23(37)18-22-6-2-3-7-25(22)27)8-9-26-29(21)33-31(34-30(26)36-15-17-40-16-10-28(36)38)39-20-32-11-4-13-35(32)14-5-12-32/h2-3,6-9,18-19,37H,4-5,10-17,20H2,1H3 |
| InChIKey | QSLGTSPQXLMUAI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |