C31H34N4O4S — CID 166162612
4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-7-yl]naphthalen-2-ol (PubChem CID 166162612) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is 4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 166162612 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methylquinazolin-7-yl]naphthalen-2-ol |
| SMILES | Cc1c(-c2cc(O)cc3ccccc23)ccc2c(N3CCS(=O)(=O)CC3)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C31H34N4O4S/c1-21-24(27-19-23(36)18-22-6-2-3-7-25(22)27)8-9-26-28(21)32-30(33-29(26)34-14-16-40(37,38)17-15-34)39-20-31-10-4-12-35(31)13-5-11-31/h2-3,6-9,18-19,36H,4-5,10-17,20H2,1H3 |
| InChIKey | UPYWICMJVOZARD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |