C29H36N6O2 — CID 166162635
2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methyl-4-(1,4-oxazepan-4-yl)quinazoline-7-carboximidoyl]aniline (PubChem CID 166162635) has the molecular formula C29H36N6O2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methyl-4-(1,4-oxazepan-4-yl)quinazoline-7-carboximidoyl]aniline.
| Compound Name | 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methyl-4-(1,4-oxazepan-4-yl)quinazoline-7-carboximidoyl]aniline |
|---|---|
| PubChem CID | 166162635 |
| Molecular Formula | C29H36N6O2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-8-methyl-4-(1,4-oxazepan-4-yl)quinazoline-7-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccccc1N)c1ccc2c(N3CCCOCC3)nc(OCC34CCCN3CCC4)nc2c1C |
| InChI | InChI=1S/C29H36N6O2/c1-20-21(25(31)22-7-2-3-8-24(22)30)9-10-23-26(20)32-28(33-27(23)34-13-6-17-36-18-16-34)37-19-29-11-4-14-35(29)15-5-12-29/h2-3,7-10,31H,4-6,11-19,30H2,1H3/b31-25- |
| InChIKey | VXUFZROQWACIJU-GDWJVWIDSA-N |
| XLogP | 4.17 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|