C22H26FNO4 — CID 166163601
ethyl 2-[4-[(2-fluorophenyl)methyl]-2-(4-methylcyclohexyl)imino-5-oxofuran-3-yl]acetate (PubChem CID 166163601) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is ethyl 2-[4-[(2-fluorophenyl)methyl]-2-(4-methylcyclohexyl)imino-5-oxofuran-3-yl]acetate.
| Compound Name | ethyl 2-[4-[(2-fluorophenyl)methyl]-2-(4-methylcyclohexyl)imino-5-oxofuran-3-yl]acetate |
|---|---|
| PubChem CID | 166163601 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 2-[4-[(2-fluorophenyl)methyl]-2-(4-methylcyclohexyl)imino-5-oxofuran-3-yl]acetate |
| SMILES | CCOC(=O)CC1=C(Cc2ccccc2F)C(=O)O/C1=N\C1CCC(C)CC1 |
| InChI | InChI=1S/C22H26FNO4/c1-3-27-20(25)13-17-18(12-15-6-4-5-7-19(15)23)22(26)28-21(17)24-16-10-8-14(2)9-11-16/h4-7,14,16H,3,8-13H2,1-2H3/b24-21- |
| InChIKey | HAJPBWBGBYITAI-FLFQWRMESA-N |
| XLogP | 4.15 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|