C14H17ClN4O2 — CID 166164483
2-chloro-4-morpholin-4-yl-6-pyrrolidin-3-ylfuro[3,2-d]pyrimidine (PubChem CID 166164483) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-chloro-4-morpholin-4-yl-6-pyrrolidin-3-ylfuro[3,2-d]pyrimidine.
| Compound Name | 2-chloro-4-morpholin-4-yl-6-pyrrolidin-3-ylfuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 166164483 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-chloro-4-morpholin-4-yl-6-pyrrolidin-3-ylfuro[3,2-d]pyrimidine |
| SMILES | Clc1nc(N2CCOCC2)c2oc(C3CCNC3)cc2n1 |
| InChI | InChI=1S/C14H17ClN4O2/c15-14-17-10-7-11(9-1-2-16-8-9)21-12(10)13(18-14)19-3-5-20-6-4-19/h7,9,16H,1-6,8H2 |
| InChIKey | QKWTUBYYXUWWCN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |