C13H19N3 — CID 166164796
(1Z,3E)-1-N'-methyl-3-(6-methyl-2-pyridinyl)hexa-1,3-diene-1,1-diamine (PubChem CID 166164796) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (1Z,3E)-1-N'-methyl-3-(6-methyl-2-pyridinyl)hexa-1,3-diene-1,1-diamine.
| Compound Name | (1Z,3E)-1-N'-methyl-3-(6-methyl-2-pyridinyl)hexa-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 166164796 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (1Z,3E)-1-N'-methyl-3-(6-methyl-2-pyridinyl)hexa-1,3-diene-1,1-diamine |
| SMILES | CC/C=C(\C=C(\N)NC)c1cccc(C)n1 |
| InChI | InChI=1S/C13H19N3/c1-4-6-11(9-13(14)15-3)12-8-5-7-10(2)16-12/h5-9,15H,4,14H2,1-3H3/b11-6+,13-9- |
| InChIKey | ICDFFAJZPSMKBS-JODYEUIASA-N |
| XLogP | 2.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|