C26H40N4 — CID 169258678
4-[(Z)-3-(6-methyl-2-pyridinyl)but-2-en-2-yl]pyridin-2-amine;N-[(E)-pent-2-en-2-yl]hexan-1-amine (PubChem CID 169258678) has the molecular formula C26H40N4 and a molecular weight of 408.63 g/mol. Its IUPAC name is 4-[(Z)-3-(6-methyl-2-pyridinyl)but-2-en-2-yl]pyridin-2-amine;N-[(E)-pent-2-en-2-yl]hexan-1-amine.
| Compound Name | 4-[(Z)-3-(6-methyl-2-pyridinyl)but-2-en-2-yl]pyridin-2-amine;N-[(E)-pent-2-en-2-yl]hexan-1-amine |
|---|---|
| PubChem CID | 169258678 |
| Molecular Formula | C26H40N4 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | 4-[(Z)-3-(6-methyl-2-pyridinyl)but-2-en-2-yl]pyridin-2-amine;N-[(E)-pent-2-en-2-yl]hexan-1-amine |
| SMILES | C/C(=C(\C)c1cccc(C)n1)c1ccnc(N)c1.CC/C=C(\C)NCCCCCC |
| InChI | InChI=1S/C15H17N3.C11H23N/c1-10-5-4-6-14(18-10)12(3)11(2)13-7-8-17-15(16)9-13;1-4-6-7-8-10-12-11(3)9-5-2/h4-9H,1-3H3,(H2,16,17);9,12H,4-8,10H2,1-3H3/b12-11-;11-9+ |
| InChIKey | WJZVGTIHZVJIDZ-HKMPZVHFSA-N |
| XLogP | 6.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|