About 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane
3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane (PubChem CID 166167809) has the molecular formula C20H38N2O4
and a molecular weight of 370.53 g/mol. Its IUPAC name is 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane.
Molecular Properties
| Compound Name | 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane |
| PubChem CID | 166167809 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane |
| SMILES | CC.CC.CCCCOc1cc(NCCOCCNC)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H26N2O4.2C2H6/c1-3-4-7-22-15-11-13(16(19)20)10-14(12-15)18-6-9-21-8-5-17-2;2*1-2/h10-12,17-18H,3-9H2,1-2H3,(H,19,20);2*1-2H3 |
| InChIKey | RWSOBLQCSATXNL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane?
The IUPAC name of 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane (CID 166167809) is 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane.
What is the SMILES notation for 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane?
The canonical SMILES for 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane is CC.CC.CCCCOc1cc(NCCOCCNC)cc(C(=O)O)c1.
What is the InChIKey of 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane?
The InChIKey is RWSOBLQCSATXNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O4.2C2H6/c1-3-4-7-22-15-11-13(16(19)20)10-14(12-15)18-6-9-21-8-5-17-2;2*1-2/h10-12,17-18H,3-9H2,1-2H3,(H,19,20);2*1-2H3.
What are the key properties of 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane?
3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane has a molecular weight of 370.53 g/mol, XLogP of 4.26, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-5-[2-[2-(methylamino)ethoxy]ethylamino]benzoic acid;ethane is sourced from PubChem (CID 166167809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).