C17H26N2O6 — CID 170576674
3-butoxy-5-[2-[2-[(2-hydroxyacetyl)amino]ethoxy]ethylamino]benzoic acid (PubChem CID 170576674) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 3-butoxy-5-[2-[2-[(2-hydroxyacetyl)amino]ethoxy]ethylamino]benzoic acid.
| Compound Name | 3-butoxy-5-[2-[2-[(2-hydroxyacetyl)amino]ethoxy]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 170576674 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-butoxy-5-[2-[2-[(2-hydroxyacetyl)amino]ethoxy]ethylamino]benzoic acid |
| SMILES | CCCCOc1cc(NCCOCCNC(=O)CO)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H26N2O6/c1-2-3-6-25-15-10-13(17(22)23)9-14(11-15)18-4-7-24-8-5-19-16(21)12-20/h9-11,18,20H,2-8,12H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | CMORZRZHEDWNCH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|