C25H44N2O5 — CID 166167882
3-butoxy-5-[2-[2-(2,2,4-trimethylpentanoylamino)ethoxy]ethylamino]benzoic acid;ethane (PubChem CID 166167882) has the molecular formula C25H44N2O5 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-butoxy-5-[2-[2-(2,2,4-trimethylpentanoylamino)ethoxy]ethylamino]benzoic acid;ethane.
| Compound Name | 3-butoxy-5-[2-[2-(2,2,4-trimethylpentanoylamino)ethoxy]ethylamino]benzoic acid;ethane |
|---|---|
| PubChem CID | 166167882 |
| Molecular Formula | C25H44N2O5 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 3-butoxy-5-[2-[2-(2,2,4-trimethylpentanoylamino)ethoxy]ethylamino]benzoic acid;ethane |
| SMILES | CC.CCCCOc1cc(NCCOCCNC(=O)C(C)(C)CC(C)C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C23H38N2O5.C2H6/c1-6-7-10-30-20-14-18(21(26)27)13-19(15-20)24-8-11-29-12-9-25-22(28)23(4,5)16-17(2)3;1-2/h13-15,17,24H,6-12,16H2,1-5H3,(H,25,28)(H,26,27);1-2H3 |
| InChIKey | JDYFROPUOKUFKZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|