C15H36N2O — CID 166168805
ethane;N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine (PubChem CID 166168805) has the molecular formula C15H36N2O and a molecular weight of 260.47 g/mol. Its IUPAC name is ethane;N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine.
| Compound Name | ethane;N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166168805 |
| Molecular Formula | C15H36N2O |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.28 |
| IUPAC Name | ethane;N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine |
| SMILES | CC.CCN(C)CCN(C)CCCOCC(C)C |
| InChI | InChI=1S/C13H30N2O.C2H6/c1-6-14(4)9-10-15(5)8-7-11-16-12-13(2)3;1-2/h13H,6-12H2,1-5H3;1-2H3 |
| InChIKey | IUDZOTWSYLDFON-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|