C8H17FN2O3 — CID 166168910
N-[3-(3-amino-2-fluoropropoxy)propyl]-2-hydroxyacetamide (PubChem CID 166168910) has the molecular formula C8H17FN2O3 and a molecular weight of 208.23 g/mol. Its IUPAC name is N-[3-(3-amino-2-fluoropropoxy)propyl]-2-hydroxyacetamide.
| Compound Name | N-[3-(3-amino-2-fluoropropoxy)propyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 166168910 |
| Molecular Formula | C8H17FN2O3 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-[3-(3-amino-2-fluoropropoxy)propyl]-2-hydroxyacetamide |
| SMILES | NCC(F)COCCCNC(=O)CO |
| InChI | InChI=1S/C8H17FN2O3/c9-7(4-10)6-14-3-1-2-11-8(13)5-12/h7,12H,1-6,10H2,(H,11,13) |
| InChIKey | NYDJVQKZYRSBGB-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|