C22H17Cl2N3O3 — CID 16617034
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 16617034) has the molecular formula C22H17Cl2N3O3 and a molecular weight of 442.30 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16617034 |
| Molecular Formula | C22H17Cl2N3O3 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H17Cl2N3O3/c1-26-18-5-3-4-6-19(18)27(2)22(26)15(12-25)20(28)13-30-21(29)10-8-14-7-9-16(23)17(24)11-14/h3-11H,13H2,1-2H3/b10-8+ |
| InChIKey | FXLJWNNBELDGLG-CSKARUKUSA-N |
| XLogP | 4.44 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|