C20H15ClN4O5 — CID 30627947
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-2-nitrobenzoate (PubChem CID 30627947) has the molecular formula C20H15ClN4O5 and a molecular weight of 426.82 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 30627947 |
| Molecular Formula | C20H15ClN4O5 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-2-nitrobenzoate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])N(C)c2ccccc21 |
| InChI | InChI=1S/C20H15ClN4O5/c1-23-16-5-3-4-6-17(16)24(2)19(23)14(10-22)18(26)11-30-20(27)13-9-12(21)7-8-15(13)25(28)29/h3-9H,11H2,1-2H3 |
| InChIKey | SPGZKNJLFZQVBA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|