C23H23N5O5 — CID 43050574
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-nitroanilino)butanoate (PubChem CID 43050574) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-nitroanilino)butanoate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-nitroanilino)butanoate |
|---|---|
| PubChem CID | 43050574 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-nitroanilino)butanoate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)CCCNc2ccccc2[N+](=O)[O-])N(C)c2ccccc21 |
| InChI | InChI=1S/C23H23N5O5/c1-26-19-10-5-6-11-20(19)27(2)23(26)16(14-24)21(29)15-33-22(30)12-7-13-25-17-8-3-4-9-18(17)28(31)32/h3-6,8-11,25H,7,12-13,15H2,1-2H3 |
| InChIKey | QJZQZPFWVDZBJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|