C21H26N4O5S — CID 35635865
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 1-ethylsulfonylpiperidine-4-carboxylate (PubChem CID 35635865) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 1-ethylsulfonylpiperidine-4-carboxylate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 1-ethylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 35635865 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 1-ethylsulfonylpiperidine-4-carboxylate |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)OCC(=O)C(C#N)=C2N(C)c3ccccc3N2C)CC1 |
| InChI | InChI=1S/C21H26N4O5S/c1-4-31(28,29)25-11-9-15(10-12-25)21(27)30-14-19(26)16(13-22)20-23(2)17-7-5-6-8-18(17)24(20)3/h5-8,15H,4,9-12,14H2,1-3H3 |
| InChIKey | WGPOZDXNAPPVLB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 111.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|