C19H18N4O5 — CID 55517670
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-(2-nitroanilino)propanoate (PubChem CID 55517670) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-(2-nitroanilino)propanoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-(2-nitroanilino)propanoate |
|---|---|
| PubChem CID | 55517670 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-(2-nitroanilino)propanoate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)CCNc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N4O5/c20-11-9-14-5-7-15(8-6-14)22-18(24)13-28-19(25)10-12-21-16-3-1-2-4-17(16)23(26)27/h1-8,21H,9-10,12-13H2,(H,22,24) |
| InChIKey | GBUSSLDUSOEJJD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|