C18H23N5O3S — CID 166173014
N-ethyl-1-[2-(3-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide (PubChem CID 166173014) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-ethyl-1-[2-(3-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide.
| Compound Name | N-ethyl-1-[2-(3-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 166173014 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-ethyl-1-[2-(3-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide |
| SMILES | CCNC(=O)C1(c2ccnc(Nc3cccc(S(N)(=O)=O)c3)n2)CCCC1 |
| InChI | InChI=1S/C18H23N5O3S/c1-2-20-16(24)18(9-3-4-10-18)15-8-11-21-17(23-15)22-13-6-5-7-14(12-13)27(19,25)26/h5-8,11-12H,2-4,9-10H2,1H3,(H,20,24)(H2,19,25,26)(H,21,22,23) |
| InChIKey | FTTBWFRANWLSTL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |