C22H23N5O3S — CID 166173039
N-phenyl-1-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide (PubChem CID 166173039) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-phenyl-1-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide.
| Compound Name | N-phenyl-1-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 166173039 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-phenyl-1-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopentane-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nccc(C3(C(=O)Nc4ccccc4)CCCC3)n2)cc1 |
| InChI | InChI=1S/C22H23N5O3S/c23-31(29,30)18-10-8-17(9-11-18)26-21-24-15-12-19(27-21)22(13-4-5-14-22)20(28)25-16-6-2-1-3-7-16/h1-3,6-12,15H,4-5,13-14H2,(H,25,28)(H2,23,29,30)(H,24,26,27) |
| InChIKey | AWDMNQAYEAHWPX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |