C21H19FN6O4S — CID 165176697
1-N'-(4-fluorophenyl)-1-N'-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 165176697) has the molecular formula C21H19FN6O4S and a molecular weight of 470.49 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N'-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N'-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 165176697 |
| Molecular Formula | C21H19FN6O4S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N'-[2-(4-sulfamoylanilino)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(c2ccc(F)cc2)c2ccnc(Nc3ccc(S(N)(=O)=O)cc3)n2)CC1 |
| InChI | InChI=1S/C21H19FN6O4S/c22-13-1-5-15(6-2-13)28(19(30)21(10-11-21)18(23)29)17-9-12-25-20(27-17)26-14-3-7-16(8-4-14)33(24,31)32/h1-9,12H,10-11H2,(H2,23,29)(H2,24,31,32)(H,25,26,27) |
| InChIKey | JVVQYVGUWHXJMS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 161.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|