C27H21F2N6O5S- — CID 175340194
4-[4-(N-(1-carbamoylcyclopropanecarbonyl)-4-fluoroanilino)-2-fluorophenoxy]-2-[3-(sulfinatoamino)anilino]pyrimidine (PubChem CID 175340194) has the molecular formula C27H21F2N6O5S- and a molecular weight of 579.57 g/mol. Its IUPAC name is 4-[4-(N-(1-carbamoylcyclopropanecarbonyl)-4-fluoroanilino)-2-fluorophenoxy]-2-[3-(sulfinatoamino)anilino]pyrimidine.
| Compound Name | 4-[4-(N-(1-carbamoylcyclopropanecarbonyl)-4-fluoroanilino)-2-fluorophenoxy]-2-[3-(sulfinatoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 175340194 |
| Molecular Formula | C27H21F2N6O5S- |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 4-[4-(N-(1-carbamoylcyclopropanecarbonyl)-4-fluoroanilino)-2-fluorophenoxy]-2-[3-(sulfinatoamino)anilino]pyrimidine |
| SMILES | NC(=O)C1(C(=O)N(c2ccc(F)cc2)c2ccc(Oc3ccnc(Nc4cccc(NS(=O)[O-])c4)n3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H22F2N6O5S/c28-16-4-6-19(7-5-16)35(25(37)27(11-12-27)24(30)36)20-8-9-22(21(29)15-20)40-23-10-13-31-26(33-23)32-17-2-1-3-18(14-17)34-41(38)39/h1-10,13-15,34H,11-12H2,(H2,30,36)(H,38,39)(H,31,32,33)/p-1 |
| InChIKey | MBOUNYUKJFMCSE-UHFFFAOYSA-M |
| XLogP | 4.43 |
| TPSA | 162.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|