C23H22FN5O4 — CID 165176719
1-N'-[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 165176719) has the molecular formula C23H22FN5O4 and a molecular weight of 451.46 g/mol. Its IUPAC name is 1-N'-[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 165176719 |
| Molecular Formula | C23H22FN5O4 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-N'-[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(Nc2nccc(N(C(=O)C3(C(N)=O)CC3)c3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C23H22FN5O4/c1-32-17-8-5-15(13-18(17)33-2)27-22-26-12-9-19(28-22)29(16-6-3-14(24)4-7-16)21(31)23(10-11-23)20(25)30/h3-9,12-13H,10-11H2,1-2H3,(H2,25,30)(H,26,27,28) |
| InChIKey | BHIVHLUUQZRSOG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|