C27H33N9NaO15P2 — CID 166176134
Flavinadeninedinucleotidedisodium(FADdisodium) (PubChem CID 166176134) has the molecular formula C27H33N9NaO15P2 and a molecular weight of 808.55 g/mol.
| Compound Name | Flavinadeninedinucleotidedisodium(FADdisodium) |
|---|---|
| PubChem CID | 166176134 |
| Molecular Formula | C27H33N9NaO15P2 |
| Molecular Weight | 808.55 g/mol |
| Exact Mass | 808.15 |
| IUPAC Name | — |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)c2cc1C.[Na] |
| InChI | InChI=1S/C27H33N9O15P2.Na/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36;/h3-4,8-9,14-16,19-21,26,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H,34,42,43);/t14-,15+,16+,19-,20+,21+,26+;/m0./s1 |
| InChIKey | NQOZVHXDRLWYCQ-WQLILBPHSA-N |
| XLogP | -2.80 |
| TPSA | 362.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.55 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|