C27H34N9O15P2 — CID 136802754
CID 136802754 (PubChem CID 136802754) has the molecular formula C27H34N9O15P2 and a molecular weight of 786.56 g/mol.
| Compound Name | CID 136802754 |
|---|---|
| PubChem CID | 136802754 |
| Molecular Formula | C27H34N9O15P2 |
| Molecular Weight | 786.56 g/mol |
| Exact Mass | 786.16 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]1O)c1nc([O])[nH]c(=O)c1N2 |
| InChI | InChI=1S/C27H34N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,32,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H,33,34,42)/t14-,15+,16+,19-,20+,21+,26+/m0/s1 |
| InChIKey | ISSGPIRDEPNITQ-UYBVJOGSSA-N |
| XLogP | -0.90 |
| TPSA | 363.21 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.56 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|