C23H27FN6O — CID 166179116
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 166179116) has the molecular formula C23H27FN6O and a molecular weight of 422.51 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 166179116 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)NCc1ccc(-n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C23H27FN6O/c1-17-13-19(29-11-9-28(2)10-12-29)4-5-21(17)27-23(31)26-15-18-3-6-22(20(24)14-18)30-8-7-25-16-30/h3-8,13-14,16H,9-12,15H2,1-2H3,(H2,26,27,31) |
| InChIKey | NRPQKBUSYFOIRC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|