C22H21ClN4O2 — CID 166179492
N-[3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]phenyl]-3-imidazol-1-ylpropanamide (PubChem CID 166179492) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-[3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]phenyl]-3-imidazol-1-ylpropanamide.
| Compound Name | N-[3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]phenyl]-3-imidazol-1-ylpropanamide |
|---|---|
| PubChem CID | 166179492 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]phenyl]-3-imidazol-1-ylpropanamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(NC(=O)CCn3ccnc3)c2)cc1Cl |
| InChI | InChI=1S/C22H21ClN4O2/c1-16-5-6-17(13-20(16)23)7-8-21(28)25-18-3-2-4-19(14-18)26-22(29)9-11-27-12-10-24-15-27/h2-8,10,12-15H,9,11H2,1H3,(H,25,28)(H,26,29)/b8-7+ |
| InChIKey | LSPDJKSZCNTMAI-BQYQJAHWSA-N |
| XLogP | 4.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|