C20H26N4O3S — CID 166180121
4-pyrrolidin-1-ylsulfonyl-N-(3-pyrrol-1-ylphenyl)piperidine-1-carboxamide (PubChem CID 166180121) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 4-pyrrolidin-1-ylsulfonyl-N-(3-pyrrol-1-ylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-pyrrolidin-1-ylsulfonyl-N-(3-pyrrol-1-ylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166180121 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-pyrrolidin-1-ylsulfonyl-N-(3-pyrrol-1-ylphenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cccc2)c1)N1CCC(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c25-20(21-17-6-5-7-18(16-17)22-10-1-2-11-22)23-14-8-19(9-15-23)28(26,27)24-12-3-4-13-24/h1-2,5-7,10-11,16,19H,3-4,8-9,12-15H2,(H,21,25) |
| InChIKey | DYSSGZZJESRXML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |