C23H21F3N4O2S — CID 166180297
N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 166180297) has the molecular formula C23H21F3N4O2S and a molecular weight of 474.51 g/mol. Its IUPAC name is N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166180297 |
| Molecular Formula | C23H21F3N4O2S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(NC(=O)c3csc(-c4cccc(C(F)(F)F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H21F3N4O2S/c24-23(25,26)16-3-1-2-15(12-16)22-29-19(13-33-22)21(32)28-17-4-6-18(7-5-17)30-10-8-14(9-11-30)20(27)31/h1-7,12-14H,8-11H2,(H2,27,31)(H,28,32) |
| InChIKey | OJBKMMNQRRFZAV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|