C19H15N5O4S — CID 166182056
[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 166182056) has the molecular formula C19H15N5O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 166182056 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | Cc1nc2ncnn2c(C)c1C(=O)OCc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C19H15N5O4S/c1-10-16(11(2)24-19(22-10)20-8-21-24)18(25)26-6-13-7-29-17(23-13)12-3-4-14-15(5-12)28-9-27-14/h3-5,7-8H,6,9H2,1-2H3 |
| InChIKey | BPJRBKYKDNSYKA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |