C17H16ClN3O — CID 166183159
N-[2-[(4-chlorophenyl)methoxy]ethyl]-1,7-naphthyridin-4-amine (PubChem CID 166183159) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methoxy]ethyl]-1,7-naphthyridin-4-amine.
| Compound Name | N-[2-[(4-chlorophenyl)methoxy]ethyl]-1,7-naphthyridin-4-amine |
|---|---|
| PubChem CID | 166183159 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methoxy]ethyl]-1,7-naphthyridin-4-amine |
| SMILES | Clc1ccc(COCCNc2ccnc3cnccc23)cc1 |
| InChI | InChI=1S/C17H16ClN3O/c18-14-3-1-13(2-4-14)12-22-10-9-21-16-6-8-20-17-11-19-7-5-15(16)17/h1-8,11H,9-10,12H2,(H,20,21) |
| InChIKey | LOPMPKIAOFRJKY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|