C16H14ClN3 — CID 166233204
N-[2-(4-chlorophenyl)ethyl]-1,6-naphthyridin-4-amine (PubChem CID 166233204) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1,6-naphthyridin-4-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1,6-naphthyridin-4-amine |
|---|---|
| PubChem CID | 166233204 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1,6-naphthyridin-4-amine |
| SMILES | Clc1ccc(CCNc2ccnc3ccncc23)cc1 |
| InChI | InChI=1S/C16H14ClN3/c17-13-3-1-12(2-4-13)5-9-19-16-7-10-20-15-6-8-18-11-14(15)16/h1-4,6-8,10-11H,5,9H2,(H,19,20) |
| InChIKey | OEWQEVLIIAXOBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |