C13H11ClF2N2 — CID 167960431
N-[2-(4-chlorophenyl)ethyl]-3,5-difluoropyridin-4-amine (PubChem CID 167960431) has the molecular formula C13H11ClF2N2 and a molecular weight of 268.69 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-3,5-difluoropyridin-4-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-3,5-difluoropyridin-4-amine |
|---|---|
| PubChem CID | 167960431 |
| Molecular Formula | C13H11ClF2N2 |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-3,5-difluoropyridin-4-amine |
| SMILES | Fc1cncc(F)c1NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClF2N2/c14-10-3-1-9(2-4-10)5-6-18-13-11(15)7-17-8-12(13)16/h1-4,7-8H,5-6H2,(H,17,18) |
| InChIKey | NMZYGJIUVLSRIA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |