C16H13F2N3 — CID 167779053
3,5-difluoro-N-(2-isoquinolin-6-ylethyl)pyridin-4-amine (PubChem CID 167779053) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-isoquinolin-6-ylethyl)pyridin-4-amine.
| Compound Name | 3,5-difluoro-N-(2-isoquinolin-6-ylethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 167779053 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3,5-difluoro-N-(2-isoquinolin-6-ylethyl)pyridin-4-amine |
| SMILES | Fc1cncc(F)c1NCCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C16H13F2N3/c17-14-9-20-10-15(18)16(14)21-6-3-11-1-2-13-8-19-5-4-12(13)7-11/h1-2,4-5,7-10H,3,6H2,(H,20,21) |
| InChIKey | MFRXRMUKYXUYIM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |