C28H23N3O3 — CID 166184495
1-benzoyl-N-(2-phenoxy-3-pyridinyl)-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 166184495) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-benzoyl-N-(2-phenoxy-3-pyridinyl)-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 1-benzoyl-N-(2-phenoxy-3-pyridinyl)-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 166184495 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-benzoyl-N-(2-phenoxy-3-pyridinyl)-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | O=C(Nc1cccnc1Oc1ccccc1)c1ccc2c(c1)CCCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O3/c32-26(30-24-14-7-17-29-27(24)34-23-12-5-2-6-13-23)22-15-16-25-21(19-22)11-8-18-31(25)28(33)20-9-3-1-4-10-20/h1-7,9-10,12-17,19H,8,11,18H2,(H,30,32) |
| InChIKey | JVKBDVAATOGCME-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |