C27H28N6O3 — CID 166187475
1-benzyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 166187475) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-benzyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1-benzyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 166187475 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 1-benzyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C27H28N6O3/c1-18-14-21(32-12-10-31(2)11-13-32)8-9-23(18)29-25(34)20-15-22-24(28-16-20)33(27(36)30-26(22)35)17-19-6-4-3-5-7-19/h3-9,14-16H,10-13,17H2,1-2H3,(H,29,34)(H,30,35,36) |
| InChIKey | OYZAMFQWTLQPJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|