C26H19N7O4 — CID 166188422
[4-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-nitrophenyl]-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone (PubChem CID 166188422) has the molecular formula C26H19N7O4 and a molecular weight of 493.48 g/mol. Its IUPAC name is [4-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-nitrophenyl]-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone.
| Compound Name | [4-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-nitrophenyl]-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone |
|---|---|
| PubChem CID | 166188422 |
| Molecular Formula | C26H19N7O4 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [4-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-nitrophenyl]-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone |
| SMILES | O=C(c1ccc(C(=O)N2CCn3c2nc2ccccc23)c([N+](=O)[O-])c1)N1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C26H19N7O4/c34-23(31-13-11-29-20-7-3-1-5-18(20)27-25(29)31)16-9-10-17(22(15-16)33(36)37)24(35)32-14-12-30-21-8-4-2-6-19(21)28-26(30)32/h1-10,15H,11-14H2 |
| InChIKey | LHQXTOYKAHDELY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 119.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|