C18H15N5O5 — CID 90511987
1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-[1-(5-nitrofuran-2-carbonyl)azetidin-3-yl]methanone (PubChem CID 90511987) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-[1-(5-nitrofuran-2-carbonyl)azetidin-3-yl]methanone.
| Compound Name | 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-[1-(5-nitrofuran-2-carbonyl)azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 90511987 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-[1-(5-nitrofuran-2-carbonyl)azetidin-3-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CC(C(=O)N2CCn3c2nc2ccccc23)C1 |
| InChI | InChI=1S/C18H15N5O5/c24-16(22-8-7-21-13-4-2-1-3-12(13)19-18(21)22)11-9-20(10-11)17(25)14-5-6-15(28-14)23(26)27/h1-6,11H,7-10H2 |
| InChIKey | UEKMNFOCJZGFFL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|