C17H15Cl2NO2 — CID 166189695
3-pyridin-4-ylpropyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate (PubChem CID 166189695) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate.
| Compound Name | 3-pyridin-4-ylpropyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 166189695 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-pyridin-4-ylpropyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)OCCCc1ccncc1 |
| InChI | InChI=1S/C17H15Cl2NO2/c18-15-10-14(11-16(19)12-15)3-4-17(21)22-9-1-2-13-5-7-20-8-6-13/h3-8,10-12H,1-2,9H2/b4-3+ |
| InChIKey | UJKHLOLCBKISHM-ONEGZZNKSA-N |
| XLogP | 4.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|