C22H21NO3 — CID 166189696
3-pyridin-3-ylpropyl (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 166189696) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | 3-pyridin-3-ylpropyl (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 166189696 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-pyridin-3-ylpropyl (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COc1ccc2cc(/C=C/C(=O)OCCCc3cccnc3)ccc2c1 |
| InChI | InChI=1S/C22H21NO3/c1-25-21-10-9-19-14-17(6-8-20(19)15-21)7-11-22(24)26-13-3-5-18-4-2-12-23-16-18/h2,4,6-12,14-16H,3,5,13H2,1H3/b11-7+ |
| InChIKey | CCDYJOSWLLXBNV-YRNVUSSQSA-N |
| XLogP | 4.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|