C14H15FN2O4S — CID 166191856
2-[(4-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]acetamide (PubChem CID 166191856) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 166191856 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CNS(=O)(=O)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C14H15FN2O4S/c1-10(13-3-2-8-21-13)17-14(18)9-16-22(19,20)12-6-4-11(15)5-7-12/h2-8,10,16H,9H2,1H3,(H,17,18) |
| InChIKey | BZTVJVLCASBFFM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |