C21H20ClFN2O2 — CID 87029637
2-[[(2-chlorophenyl)-(4-fluorophenyl)methyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide (PubChem CID 87029637) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is 2-[[(2-chlorophenyl)-(4-fluorophenyl)methyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[[(2-chlorophenyl)-(4-fluorophenyl)methyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 87029637 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[(2-chlorophenyl)-(4-fluorophenyl)methyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CNC(c1ccc(F)cc1)c1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C21H20ClFN2O2/c1-14(19-7-4-12-27-19)25-20(26)13-24-21(15-8-10-16(23)11-9-15)17-5-2-3-6-18(17)22/h2-12,14,21,24H,13H2,1H3,(H,25,26) |
| InChIKey | BZEKHQJCADFUBA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |