C21H18N4O3 — CID 166196221
N-dibenzofuran-3-yl-N'-methyl-N'-(2-pyrazin-2-ylethyl)oxamide (PubChem CID 166196221) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-N'-methyl-N'-(2-pyrazin-2-ylethyl)oxamide.
| Compound Name | N-dibenzofuran-3-yl-N'-methyl-N'-(2-pyrazin-2-ylethyl)oxamide |
|---|---|
| PubChem CID | 166196221 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-dibenzofuran-3-yl-N'-methyl-N'-(2-pyrazin-2-ylethyl)oxamide |
| SMILES | CN(CCc1cnccn1)C(=O)C(=O)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C21H18N4O3/c1-25(11-8-15-13-22-9-10-23-15)21(27)20(26)24-14-6-7-17-16-4-2-3-5-18(16)28-19(17)12-14/h2-7,9-10,12-13H,8,11H2,1H3,(H,24,26) |
| InChIKey | RSDAJWLGJQCVGO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|