C17H18FNO4S — CID 16619625
propan-2-yl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 16619625) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is propan-2-yl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | propan-2-yl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16619625 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | propan-2-yl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)Nc1ccccc1C(=O)OC(C)C |
| InChI | InChI=1S/C17H18FNO4S/c1-11(2)23-17(20)14-6-4-5-7-15(14)19-24(21,22)16-9-8-13(18)10-12(16)3/h4-11,19H,1-3H3 |
| InChIKey | GDPWYKBHTLTCCT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |