C17H16FNO5S — CID 2569504
2-oxopropyl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 2569504) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-oxopropyl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | 2-oxopropyl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2569504 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-oxopropyl 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | CC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C17H16FNO5S/c1-11-9-13(18)7-8-16(11)25(22,23)19-15-6-4-3-5-14(15)17(21)24-10-12(2)20/h3-9,19H,10H2,1-2H3 |
| InChIKey | OBICODQSKJOXDK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |