C19H21FN2O6S — CID 2569341
[2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 2569341) has the molecular formula C19H21FN2O6S and a molecular weight of 424.45 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2569341 |
| Molecular Formula | C19H21FN2O6S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C19H21FN2O6S/c1-13-11-14(20)7-8-17(13)29(25,26)22-16-6-4-3-5-15(16)19(24)28-12-18(23)21-9-10-27-2/h3-8,11,22H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | NCQFOYQBPQYOHL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|