C18H23ClFN3O3S — CID 119504864
N-[2-(ethylamino)ethyl]-2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzamide;hydrochloride (PubChem CID 119504864) has the molecular formula C18H23ClFN3O3S and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119504864 |
| Molecular Formula | C18H23ClFN3O3S |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-[(4-fluoro-2-methylphenyl)sulfonylamino]benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)cc1C.Cl |
| InChI | InChI=1S/C18H22FN3O3S.ClH/c1-3-20-10-11-21-18(23)15-6-4-5-7-16(15)22-26(24,25)17-9-8-14(19)12-13(17)2;/h4-9,12,20,22H,3,10-11H2,1-2H3,(H,21,23);1H |
| InChIKey | LMRHYZDNVOWYPN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|