C19H22ClN3O4S — CID 166197839
N-(3-chloro-4-cyanophenyl)sulfonyl-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide (PubChem CID 166197839) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)sulfonyl-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)sulfonyl-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166197839 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)sulfonyl-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(=O)C2CCCN2C(=O)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O4S/c20-16-11-15(9-8-14(16)12-21)28(26,27)22-18(24)17-7-4-10-23(17)19(25)13-5-2-1-3-6-13/h8-9,11,13,17H,1-7,10H2,(H,22,24) |
| InChIKey | WXTUNIPHEZJCSK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |