C19H16F3N3O3 — CID 166197842
3'-[[3-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 166197842) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 3'-[[3-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[[3-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 166197842 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3'-[[3-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCc3ccccc32)C(=O)N1Cc1ccncc1OCC(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O3/c20-19(21,22)11-28-15-9-23-8-6-13(15)10-25-16(26)18(24-17(25)27)7-5-12-3-1-2-4-14(12)18/h1-4,6,8-9H,5,7,10-11H2,(H,24,27) |
| InChIKey | SFEPNIXVHLIQFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|