C13H11F3N2O2 — CID 99616144
(3S)-3'-(2,2,2-trifluoroethyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 99616144) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is (3S)-3'-(2,2,2-trifluoroethyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3S)-3'-(2,2,2-trifluoroethyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 99616144 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3S)-3'-(2,2,2-trifluoroethyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@]2(CCc3ccccc32)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)7-18-10(19)12(17-11(18)20)6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | IVDXTUQGNMUPQV-LBPRGKRZSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|