C19H15N3O2 — CID 166201066
4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-methylquinolin-2-one (PubChem CID 166201066) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-methylquinolin-2-one.
| Compound Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 166201066 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)cc(-c2nc(Cc3ccccc3)no2)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O2/c1-22-16-10-6-5-9-14(16)15(12-18(22)23)19-20-17(21-24-19)11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3 |
| InChIKey | GSSDNRBRTKKUSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |